C16H13N3O — CID 62880545
N-(5-cyano-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 62880545) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 62880545 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C16H13N3O/c17-10-12-6-7-14(18-11-12)19-15(20)16(8-9-16)13-4-2-1-3-5-13/h1-7,11H,8-9H2,(H,18,19,20) |
| InChIKey | WZMSSPSGXWXFHO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |