C22H22N4O — CID 146074963
6-[5-(1-phenylcyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile (PubChem CID 146074963) has the molecular formula C22H22N4O and a molecular weight of 358.44 g/mol. Its IUPAC name is 6-[5-(1-phenylcyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[5-(1-phenylcyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146074963 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 6-[5-(1-phenylcyclopropanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CC3CN(C(=O)C4(c5ccccc5)CC4)CC3C2)nc1 |
| InChI | InChI=1S/C22H22N4O/c23-10-16-6-7-20(24-11-16)25-12-17-14-26(15-18(17)13-25)21(27)22(8-9-22)19-4-2-1-3-5-19/h1-7,11,17-18H,8-9,12-15H2 |
| InChIKey | USSZMVRCZUKYLR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |