C17H17N5O2 — CID 146080152
6-[5-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile (PubChem CID 146080152) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 6-[5-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[5-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146080152 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 6-[5-(5-methyl-1,2-oxazole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]pyridine-3-carbonitrile |
| SMILES | Cc1cc(C(=O)N2CC3CN(c4ccc(C#N)cn4)CC3C2)no1 |
| InChI | InChI=1S/C17H17N5O2/c1-11-4-15(20-24-11)17(23)22-9-13-7-21(8-14(13)10-22)16-3-2-12(5-18)6-19-16/h2-4,6,13-14H,7-10H2,1H3 |
| InChIKey | KQWGADWEOYXFBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |