C17H17N5O — CID 2746537
4-(5-cyano-2-pyridinyl)-N-phenylpiperazine-1-carboxamide (PubChem CID 2746537) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 4-(5-cyano-2-pyridinyl)-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-(5-cyano-2-pyridinyl)-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 2746537 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-(5-cyano-2-pyridinyl)-N-phenylpiperazine-1-carboxamide |
| SMILES | N#Cc1ccc(N2CCN(C(=O)Nc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C17H17N5O/c18-12-14-6-7-16(19-13-14)21-8-10-22(11-9-21)17(23)20-15-4-2-1-3-5-15/h1-7,13H,8-11H2,(H,20,23) |
| InChIKey | MCWOJRBAHATSFY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |