C17H23N5O — CID 47069365
4-(5-cyano-2-pyridinyl)-N-(cyclopentylmethyl)piperazine-1-carboxamide (PubChem CID 47069365) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(5-cyano-2-pyridinyl)-N-(cyclopentylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-(5-cyano-2-pyridinyl)-N-(cyclopentylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 47069365 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-(5-cyano-2-pyridinyl)-N-(cyclopentylmethyl)piperazine-1-carboxamide |
| SMILES | N#Cc1ccc(N2CCN(C(=O)NCC3CCCC3)CC2)nc1 |
| InChI | InChI=1S/C17H23N5O/c18-11-15-5-6-16(19-13-15)21-7-9-22(10-8-21)17(23)20-12-14-3-1-2-4-14/h5-6,13-14H,1-4,7-10,12H2,(H,20,23) |
| InChIKey | WOXZHNCTQZRJBJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |