C9H10N4O — CID 79153512
3-(5-cyano-2-pyridinyl)-1,1-dimethylurea (PubChem CID 79153512) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-(5-cyano-2-pyridinyl)-1,1-dimethylurea.
| Compound Name | 3-(5-cyano-2-pyridinyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79153512 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-(5-cyano-2-pyridinyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C9H10N4O/c1-13(2)9(14)12-8-4-3-7(5-10)6-11-8/h3-4,6H,1-2H3,(H,11,12,14) |
| InChIKey | YKEQSDKIAKYYFN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |