C13H11N5O — CID 104670305
N-(5-cyano-2-pyridinyl)-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 104670305) has the molecular formula C13H11N5O and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-3,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-3,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104670305 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C#N)cn2)c(C)nn1 |
| InChI | InChI=1S/C13H11N5O/c1-8-5-11(9(2)18-17-8)13(19)16-12-4-3-10(6-14)7-15-12/h3-5,7H,1-2H3,(H,15,16,19) |
| InChIKey | GDIJYOBPCNULMZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |