C11H8N4O2 — CID 79502806
N-(5-cyano-2-pyridinyl)-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 79502806) has the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 79502806 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C11H8N4O2/c1-7-10(17-6-14-7)11(16)15-9-3-2-8(4-12)5-13-9/h2-3,5-6H,1H3,(H,13,15,16) |
| InChIKey | ZLVHMQPKXMDLNE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |