C14H9N3O3 — CID 62354122
N-(5-cyano-2-pyridinyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 62354122) has the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 62354122 |
| Molecular Formula | C14H9N3O3 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C14H9N3O3/c15-6-9-1-4-13(16-7-9)17-14(18)10-2-3-11-12(5-10)20-8-19-11/h1-5,7H,8H2,(H,16,17,18) |
| InChIKey | JDMZXEOQUDBFMK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |