C14H12N2O3 — CID 669665
N-(5-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 669665) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 669665 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C14H12N2O3/c1-9-2-5-13(15-7-9)16-14(17)10-3-4-11-12(6-10)19-8-18-11/h2-7H,8H2,1H3,(H,15,16,17) |
| InChIKey | OXMSYBVJTYDNIK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |