C19H14N2O3 — CID 75493566
N-(5-phenyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 75493566) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-(5-phenyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-phenyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 75493566 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(5-phenyl-2-pyridinyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H14N2O3/c22-19(14-6-8-16-17(10-14)24-12-23-16)21-18-9-7-15(11-20-18)13-4-2-1-3-5-13/h1-11H,12H2,(H,20,21,22) |
| InChIKey | KSUOIGYXPBRQMU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |