C17H13N3O3 — CID 35532209
N-(5-phenyl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 35532209) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-(5-phenyl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-phenyl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 35532209 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(5-phenyl-1H-pyrazol-3-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccccc2)[nH]n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13N3O3/c21-17(12-6-7-14-15(8-12)23-10-22-14)18-16-9-13(19-20-16)11-4-2-1-3-5-11/h1-9H,10H2,(H2,18,19,20,21) |
| InChIKey | HUVRBFZBTWHMSI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |