C18H13NO3 — CID 959403
N-naphthalen-2-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 959403) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-naphthalen-2-yl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-naphthalen-2-yl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 959403 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-naphthalen-2-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13NO3/c20-18(14-6-8-16-17(10-14)22-11-21-16)19-15-7-5-12-3-1-2-4-13(12)9-15/h1-10H,11H2,(H,19,20) |
| InChIKey | HCMVZOSMUOEOKA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |