C16H15NO5 — CID 16619123
N-(3,4-dimethoxyphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 16619123) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 16619123 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C16H15NO5/c1-19-12-6-4-11(8-14(12)20-2)17-16(18)10-3-5-13-15(7-10)22-9-21-13/h3-8H,9H2,1-2H3,(H,17,18) |
| InChIKey | HPTYFHNOIAUFRJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |