C22H20N2O5 — CID 112989157
N-[4-(1,3-benzodioxol-5-ylamino)phenyl]-3,4-dimethoxybenzamide (PubChem CID 112989157) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-ylamino)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-ylamino)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 112989157 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-ylamino)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Nc3ccc4c(c3)OCO4)cc2)cc1OC |
| InChI | InChI=1S/C22H20N2O5/c1-26-18-9-3-14(11-20(18)27-2)22(25)24-16-6-4-15(5-7-16)23-17-8-10-19-21(12-17)29-13-28-19/h3-12,23H,13H2,1-2H3,(H,24,25) |
| InChIKey | BTUXSDCBLZIUBN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |