C15H12N2O6 — CID 2205336
N-(4-methoxy-3-nitrophenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 2205336) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is N-(4-methoxy-3-nitrophenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-methoxy-3-nitrophenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 2205336 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(4-methoxy-3-nitrophenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N2O6/c1-21-12-5-3-10(7-11(12)17(19)20)16-15(18)9-2-4-13-14(6-9)23-8-22-13/h2-7H,8H2,1H3,(H,16,18) |
| InChIKey | JUMDBKRGSDAKOM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|