C16H14N2O7 — CID 110443650
N-(4,5-dimethoxy-2-nitrophenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 110443650) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-nitrophenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4,5-dimethoxy-2-nitrophenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110443650 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(4,5-dimethoxy-2-nitrophenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3c(c2)OCO3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H14N2O7/c1-22-13-6-10(11(18(20)21)7-14(13)23-2)17-16(19)9-3-4-12-15(5-9)25-8-24-12/h3-7H,8H2,1-2H3,(H,17,19) |
| InChIKey | FHIFVMJAKICNTH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|