C19H17NO9 — CID 40712567
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 40712567) has the molecular formula C19H17NO9 and a molecular weight of 403.34 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 40712567 |
| Molecular Formula | C19H17NO9 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCC(=O)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C19H17NO9/c1-3-26-18-8-13(20(23)24)12(7-16(18)25-2)19(22)27-9-14(21)11-4-5-15-17(6-11)29-10-28-15/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | LWTCAJHFJZWTEW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|