C18H13F2NO9 — CID 41407292
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 41407292) has the molecular formula C18H13F2NO9 and a molecular weight of 425.30 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 41407292 |
| Molecular Formula | C18H13F2NO9 |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2ccc3c(c2)OCO3)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H13F2NO9/c1-26-14-5-10(11(21(24)25)6-16(14)30-18(19)20)17(23)27-7-12(22)9-2-3-13-15(4-9)29-8-28-13/h2-6,18H,7-8H2,1H3 |
| InChIKey | ICQNUHKEXQGDNS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|