C24H22N2O9 — CID 5129614
[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 5129614) has the molecular formula C24H22N2O9 and a molecular weight of 482.45 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 5129614 |
| Molecular Formula | C24H22N2O9 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2cc(C)n(-c3ccc4c(c3)OCO4)c2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H22N2O9/c1-13-7-16(14(2)25(13)15-5-6-20-23(8-15)35-12-34-20)19(27)11-33-24(28)17-9-21(31-3)22(32-4)10-18(17)26(29)30/h5-10H,11-12H2,1-4H3 |
| InChIKey | XLKPHQWSUXNZMG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 128.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|