C19H18N2O7 — CID 18194012
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18194012) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18194012 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c1C |
| InChI | InChI=1S/C19H18N2O7/c1-4-5-20-11(2)6-13(12(20)3)16(22)9-26-19(23)14-7-17-18(28-10-27-17)8-15(14)21(24)25/h4,6-8H,1,5,9-10H2,2-3H3 |
| InChIKey | WHUZNZUWZWZNDU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|