C25H22N2O9 — CID 2098165
3-O-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 2098165) has the molecular formula C25H22N2O9 and a molecular weight of 494.46 g/mol. Its IUPAC name is 3-O-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2098165 |
| Molecular Formula | C25H22N2O9 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 3-O-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)c2cc(C)n(Cc3ccc4c(c3)OCO4)c2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N2O9/c1-14-6-20(15(2)26(14)11-16-4-5-22-23(7-16)36-13-35-22)21(28)12-34-25(30)18-8-17(24(29)33-3)9-19(10-18)27(31)32/h4-10H,11-13H2,1-3H3 |
| InChIKey | UPBBTIITUNJVAC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 136.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|