C18H13NO9 — CID 8020847
3-O-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 8020847) has the molecular formula C18H13NO9 and a molecular weight of 387.30 g/mol. Its IUPAC name is 3-O-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8020847 |
| Molecular Formula | C18H13NO9 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-O-[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)c2ccc3c(c2)OCO3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13NO9/c1-25-17(21)11-4-12(6-13(5-11)19(23)24)18(22)26-8-14(20)10-2-3-15-16(7-10)28-9-27-15/h2-7H,8-9H2,1H3 |
| InChIKey | YXBXISMAICYYGD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|