C15H9N3O9 — CID 21177389
[2-(3-nitrophenyl)-2-oxoethyl] 3,5-dinitrobenzoate (PubChem CID 21177389) has the molecular formula C15H9N3O9 and a molecular weight of 375.25 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 3,5-dinitrobenzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 21177389 |
| Molecular Formula | C15H9N3O9 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 3,5-dinitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9N3O9/c19-14(9-2-1-3-11(4-9)16(21)22)8-27-15(20)10-5-12(17(23)24)7-13(6-10)18(25)26/h1-7H,8H2 |
| InChIKey | LKGCNZFPQMRMLR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 172.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|