C18H17NO5 — CID 7768454
[2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-nitrobenzoate (PubChem CID 7768454) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7768454 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-nitrobenzoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2cccc([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C18H17NO5/c1-11-7-12(2)17(13(3)8-11)16(20)10-24-18(21)14-5-4-6-15(9-14)19(22)23/h4-9H,10H2,1-3H3 |
| InChIKey | BOCOFTBMEXABHS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|