C15H9Cl2NO5 — CID 7769380
[2-(2,4-dichlorophenyl)-2-oxoethyl] 3-nitrobenzoate (PubChem CID 7769380) has the molecular formula C15H9Cl2NO5 and a molecular weight of 354.15 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7769380 |
| Molecular Formula | C15H9Cl2NO5 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 3-nitrobenzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9Cl2NO5/c16-10-4-5-12(13(17)7-10)14(19)8-23-15(20)9-2-1-3-11(6-9)18(21)22/h1-7H,8H2 |
| InChIKey | RMULUIXUVTXUBE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|