C21H20Cl2N2O5 — CID 23966023
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate (PubChem CID 23966023) has the molecular formula C21H20Cl2N2O5 and a molecular weight of 451.31 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23966023 |
| Molecular Formula | C21H20Cl2N2O5 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)cc1Cl)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20Cl2N2O5/c22-15-6-7-16(17(23)12-15)20(26)13-30-21(27)14-5-8-18(19(11-14)25(28)29)24-9-3-1-2-4-10-24/h5-8,11-12H,1-4,9-10,13H2 |
| InChIKey | KIMOWOLGXGXFAD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|