C24H26N2O5 — CID 7857832
[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate (PubChem CID 7857832) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7857832 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C24H26N2O5/c27-23(19-9-8-17-6-5-7-18(17)14-19)16-31-24(28)20-10-11-21(22(15-20)26(29)30)25-12-3-1-2-4-13-25/h8-11,14-15H,1-7,12-13,16H2 |
| InChIKey | OCIQRDGAPMIDFF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|