C19H21N5O7 — CID 4519274
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 4519274) has the molecular formula C19H21N5O7 and a molecular weight of 431.41 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 4519274 |
| Molecular Formula | C19H21N5O7 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H21N5O7/c1-21-16(20)15(17(26)22(2)19(21)28)14(25)10-31-18(27)11-5-6-12(13(9-11)24(29)30)23-7-3-4-8-23/h5-6,9H,3-4,7-8,10,20H2,1-2H3 |
| InChIKey | FCMKYXAHMPSYRB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|