C15H15N5O7 — CID 3947379
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 3947379) has the molecular formula C15H15N5O7 and a molecular weight of 377.31 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 3947379 |
| Molecular Formula | C15H15N5O7 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)c2ccc(N)c([N+](=O)[O-])c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H15N5O7/c1-18-12(17)11(13(22)19(2)15(18)24)10(21)6-27-14(23)7-3-4-8(16)9(5-7)20(25)26/h3-5H,6,16-17H2,1-2H3 |
| InChIKey | WOQIGEJOFNKUOO-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 182.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|