C15H14N4O7 — CID 2352495
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitrobenzoate (PubChem CID 2352495) has the molecular formula C15H14N4O7 and a molecular weight of 362.30 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2352495 |
| Molecular Formula | C15H14N4O7 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 3-nitrobenzoate |
| SMILES | Cn1c(N)c(C(=O)COC(=O)c2cccc([N+](=O)[O-])c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H14N4O7/c1-17-12(16)11(13(21)18(2)15(17)23)10(20)7-26-14(22)8-4-3-5-9(6-8)19(24)25/h3-6H,7,16H2,1-2H3 |
| InChIKey | NYFPOMSTJLYGJF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|