C13H15N3O5 — CID 7858037
(2-amino-2-oxoethyl) 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 7858037) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 7858037 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | NC(=O)COC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N3O5/c14-12(17)8-21-13(18)9-3-4-10(11(7-9)16(19)20)15-5-1-2-6-15/h3-4,7H,1-2,5-6,8H2,(H2,14,17) |
| InChIKey | GUGSMLHAOZFASP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|