C22H24N4O6 — CID 27310596
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 27310596) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 27310596 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O6/c23-20(27)10-13-25(17-6-2-1-3-7-17)21(28)15-32-22(29)16-8-9-18(19(14-16)26(30)31)24-11-4-5-12-24/h1-3,6-9,14H,4-5,10-13,15H2,(H2,23,27) |
| InChIKey | ORVVEWGADCIFSU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|