C19H18FN3O6 — CID 27311795
[2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate (PubChem CID 27311795) has the molecular formula C19H18FN3O6 and a molecular weight of 403.37 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 27311795 |
| Molecular Formula | C19H18FN3O6 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCC(=O)N(CCC(N)=O)c2ccc(F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18FN3O6/c1-12-10-13(2-7-16(12)23(27)28)19(26)29-11-18(25)22(9-8-17(21)24)15-5-3-14(20)4-6-15/h2-7,10H,8-9,11H2,1H3,(H2,21,24) |
| InChIKey | PQNPDMGPIZUEHD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|