C21H23FN2O6 — CID 26961717
[2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 26961717) has the molecular formula C21H23FN2O6 and a molecular weight of 418.42 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 26961717 |
| Molecular Formula | C21H23FN2O6 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N(CCC(N)=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H23FN2O6/c1-3-29-17-9-4-14(12-18(17)28-2)21(27)30-13-20(26)24(11-10-19(23)25)16-7-5-15(22)6-8-16/h4-9,12H,3,10-11,13H2,1-2H3,(H2,23,25) |
| InChIKey | BRJCOHCFJCUWTJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |