C19H16F4N2O4 — CID 27310320
[2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-(trifluoromethyl)benzoate (PubChem CID 27310320) has the molecular formula C19H16F4N2O4 and a molecular weight of 412.34 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 27310320 |
| Molecular Formula | C19H16F4N2O4 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl] 4-(trifluoromethyl)benzoate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F4N2O4/c20-14-5-7-15(8-6-14)25(10-9-16(24)26)17(27)11-29-18(28)12-1-3-13(4-2-12)19(21,22)23/h1-8H,9-11H2,(H2,24,26) |
| InChIKey | HQCQFKGTZAAQAE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |