C25H22N2O5 — CID 24526690
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 24526690) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 24526690 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)c1ccc(C(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O5/c26-22(28)15-16-27(21-9-5-2-6-10-21)23(29)17-32-25(31)20-13-11-19(12-14-20)24(30)18-7-3-1-4-8-18/h1-14H,15-17H2,(H2,26,28) |
| InChIKey | WPGFPLQKOVEXTA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |