C20H22N2O4S — CID 37325499
[2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-phenylsulfanylpropanoate (PubChem CID 37325499) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 37325499 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [2-(N-(3-amino-3-oxopropyl)anilino)-2-oxoethyl] 3-phenylsulfanylpropanoate |
| SMILES | NC(=O)CCN(C(=O)COC(=O)CCSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O4S/c21-18(23)11-13-22(16-7-3-1-4-8-16)19(24)15-26-20(25)12-14-27-17-9-5-2-6-10-17/h1-10H,11-15H2,(H2,21,23) |
| InChIKey | XLCWDGBPUTZXFW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |