C12H15NO3S — CID 2583585
(2-amino-2-oxoethyl) 3-(4-methylphenyl)sulfanylpropanoate (PubChem CID 2583585) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | (2-amino-2-oxoethyl) 3-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 2583585 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(4-methylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)OCC(N)=O)cc1 |
| InChI | InChI=1S/C12H15NO3S/c1-9-2-4-10(5-3-9)17-7-6-12(15)16-8-11(13)14/h2-5H,6-8H2,1H3,(H2,13,14) |
| InChIKey | AUGZLRVDHZOAGN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |