C17H19NO3S2 — CID 29155630
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-(4-methylphenyl)sulfanylpropanoate (PubChem CID 29155630) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 29155630 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-(4-methylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)OCC(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C17H19NO3S2/c1-13-4-6-14(7-5-13)23-10-8-17(20)21-12-16(19)18-11-15-3-2-9-22-15/h2-7,9H,8,10-12H2,1H3,(H,18,19) |
| InChIKey | LWWTUEXNWOIRAB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |