C17H16N2O3S2 — CID 8855148
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate (PubChem CID 8855148) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8855148 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)OCC(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-12-2-4-14(5-3-12)23-9-7-16(21)22-11-15(20)19-17-13(10-18)6-8-24-17/h2-6,8H,7,9,11H2,1H3,(H,19,20) |
| InChIKey | MJCKEGKQJNYYFS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |