C18H20N2OS2 — CID 9042639
3-(4-tert-butylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide (PubChem CID 9042639) has the molecular formula C18H20N2OS2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide.
| Compound Name | 3-(4-tert-butylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 9042639 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfanyl-N-(3-cyanothiophen-2-yl)propanamide |
| SMILES | CC(C)(C)c1ccc(SCCC(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C18H20N2OS2/c1-18(2,3)14-4-6-15(7-5-14)22-11-9-16(21)20-17-13(12-19)8-10-23-17/h4-8,10H,9,11H2,1-3H3,(H,20,21) |
| InChIKey | AHXOJEAWKSEIPJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |