C11H13N3O3S — CID 65263781
2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-2-methylpropanoic acid (PubChem CID 65263781) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 65263781 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NCC(=O)Nc1sccc1C#N)C(=O)O |
| InChI | InChI=1S/C11H13N3O3S/c1-11(2,10(16)17)13-6-8(15)14-9-7(5-12)3-4-18-9/h3-4,13H,6H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | FEOWQJAEVTXVQN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |