C11H13N3O3S — CID 43473525
4-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]butanoic acid (PubChem CID 43473525) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]butanoic acid.
| Compound Name | 4-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43473525 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-[[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]amino]butanoic acid |
| SMILES | N#Cc1ccsc1NC(=O)CNCCCC(=O)O |
| InChI | InChI=1S/C11H13N3O3S/c12-6-8-3-5-18-11(8)14-9(15)7-13-4-1-2-10(16)17/h3,5,13H,1-2,4,7H2,(H,14,15)(H,16,17) |
| InChIKey | DXWSQAUVUXDICW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|