C14H12N2OS — CID 2137658
N-(3-cyanothiophen-2-yl)-3,4-dimethylbenzamide (PubChem CID 2137658) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3,4-dimethylbenzamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 2137658 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2sccc2C#N)cc1C |
| InChI | InChI=1S/C14H12N2OS/c1-9-3-4-11(7-10(9)2)13(17)16-14-12(8-15)5-6-18-14/h3-7H,1-2H3,(H,16,17) |
| InChIKey | YBIZEZWQIMZRLS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |