C14H13N3O3S2 — CID 2105110
N-(3-cyanothiophen-2-yl)-4-(dimethylsulfamoyl)benzamide (PubChem CID 2105110) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2105110 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C14H13N3O3S2/c1-17(2)22(19,20)12-5-3-10(4-6-12)13(18)16-14-11(9-15)7-8-21-14/h3-8H,1-2H3,(H,16,18) |
| InChIKey | ZIJMVSRTJRVXQP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |