C17H19N3O3S2 — CID 2137686
4-[butyl(methyl)sulfamoyl]-N-(3-cyanothiophen-2-yl)benzamide (PubChem CID 2137686) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[butyl(methyl)sulfamoyl]-N-(3-cyanothiophen-2-yl)benzamide.
| Compound Name | 4-[butyl(methyl)sulfamoyl]-N-(3-cyanothiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 2137686 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-[butyl(methyl)sulfamoyl]-N-(3-cyanothiophen-2-yl)benzamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(C(=O)Nc2sccc2C#N)cc1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-3-4-10-20(2)25(22,23)15-7-5-13(6-8-15)16(21)19-17-14(12-18)9-11-24-17/h5-9,11H,3-4,10H2,1-2H3,(H,19,21) |
| InChIKey | DAZYDFWDMLBOEM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |