C16H16ClN3O3S2 — CID 8914920
4-chloro-N-(3-cyanothiophen-2-yl)-3-(diethylsulfamoyl)benzamide (PubChem CID 8914920) has the molecular formula C16H16ClN3O3S2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 4-chloro-N-(3-cyanothiophen-2-yl)-3-(diethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-(3-cyanothiophen-2-yl)-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 8914920 |
| Molecular Formula | C16H16ClN3O3S2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 4-chloro-N-(3-cyanothiophen-2-yl)-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2sccc2C#N)ccc1Cl |
| InChI | InChI=1S/C16H16ClN3O3S2/c1-3-20(4-2)25(22,23)14-9-11(5-6-13(14)17)15(21)19-16-12(10-18)7-8-24-16/h5-9H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | SRZBDMNJFYVZMQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |