C20H22ClN3O3S — CID 55594718
4-chloro-N-[1-(4-cyanophenyl)ethyl]-3-(diethylsulfamoyl)benzamide (PubChem CID 55594718) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-cyanophenyl)ethyl]-3-(diethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[1-(4-cyanophenyl)ethyl]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55594718 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-chloro-N-[1-(4-cyanophenyl)ethyl]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NC(C)c2ccc(C#N)cc2)ccc1Cl |
| InChI | InChI=1S/C20H22ClN3O3S/c1-4-24(5-2)28(26,27)19-12-17(10-11-18(19)21)20(25)23-14(3)16-8-6-15(13-22)7-9-16/h6-12,14H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | WLWZXIZMYQBXLR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |