C18H18ClN3O3S — CID 9101511
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-cyanobenzamide (PubChem CID 9101511) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-cyanobenzamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 9101511 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-cyanobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2cccc(C#N)c2)ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O3S/c1-3-22(4-2)26(24,25)17-11-15(8-9-16(17)19)21-18(23)14-7-5-6-13(10-14)12-20/h5-11H,3-4H2,1-2H3,(H,21,23) |
| InChIKey | CHTNSDLBQCKHJC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |